C43H39ClN2O5 — CID 170161933
[(2-chlorophenyl)-diphenylmethyl] 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-piperidin-1-ylbutanoate (PubChem CID 170161933) has the molecular formula C43H39ClN2O5 and a molecular weight of 699.25 g/mol. Its IUPAC name is [(2-chlorophenyl)-diphenylmethyl] 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-piperidin-1-ylbutanoate.
| Compound Name | [(2-chlorophenyl)-diphenylmethyl] 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-piperidin-1-ylbutanoate |
|---|---|
| PubChem CID | 170161933 |
| Molecular Formula | C43H39ClN2O5 |
| Molecular Weight | 699.25 g/mol |
| Exact Mass | 698.25 |
| IUPAC Name | [(2-chlorophenyl)-diphenylmethyl] 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-piperidin-1-ylbutanoate |
| SMILES | O=C(CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CCCCC1)OC(c1ccccc1)(c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C43H39ClN2O5/c44-38-25-13-12-24-37(38)43(30-16-4-1-5-17-30,31-18-6-2-7-19-31)51-40(47)28-39(41(48)46-26-14-3-15-27-46)45-42(49)50-29-36-34-22-10-8-20-32(34)33-21-9-11-23-35(33)36/h1-2,4-13,16-25,36,39H,3,14-15,26-29H2,(H,45,49) |
| InChIKey | GBIICMOMDVXXGG-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.25 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|