C57H67ClN2O5 — CID 155088512
[(2-chlorophenyl)-(4-cyclodecylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[methyl(octyl)amino]-4-oxobutanoate (PubChem CID 155088512) has the molecular formula C57H67ClN2O5 and a molecular weight of 895.62 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-cyclodecylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[methyl(octyl)amino]-4-oxobutanoate.
| Compound Name | [(2-chlorophenyl)-(4-cyclodecylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[methyl(octyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 155088512 |
| Molecular Formula | C57H67ClN2O5 |
| Molecular Weight | 895.62 g/mol |
| Exact Mass | 894.47 |
| IUPAC Name | [(2-chlorophenyl)-(4-cyclodecylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[methyl(octyl)amino]-4-oxobutanoate |
| SMILES | CCCCCCCCN(C)C(=O)[C@H](CC(=O)OC(c1ccccc1)(c1ccc(C2CCCCCCCCC2)cc1)c1ccccc1Cl)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C57H67ClN2O5/c1-3-4-5-6-12-24-39-60(2)55(62)53(59-56(63)64-41-50-48-31-20-18-29-46(48)47-30-19-21-32-49(47)50)40-54(61)65-57(44-27-16-13-17-28-44,51-33-22-23-34-52(51)58)45-37-35-43(36-38-45)42-25-14-10-8-7-9-11-15-26-42/h13,16-23,27-38,42,50,53H,3-12,14-15,24-26,39-41H2,1-2H3,(H,59,63)/t53-,57?/m0/s1 |
| InChIKey | IQDNLCYSRTXJAU-OKXYDJHRSA-N |
| XLogP | 13.90 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.62 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|