C51H53ClN2O5 — CID 146562506
[(2-chlorophenyl)-(4-cyclooctylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-piperidin-1-ylbutanoate (PubChem CID 146562506) has the molecular formula C51H53ClN2O5 and a molecular weight of 809.45 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-cyclooctylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-piperidin-1-ylbutanoate.
| Compound Name | [(2-chlorophenyl)-(4-cyclooctylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-piperidin-1-ylbutanoate |
|---|---|
| PubChem CID | 146562506 |
| Molecular Formula | C51H53ClN2O5 |
| Molecular Weight | 809.45 g/mol |
| Exact Mass | 808.36 |
| IUPAC Name | [(2-chlorophenyl)-(4-cyclooctylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-piperidin-1-ylbutanoate |
| SMILES | O=C(C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CCCCC1)OC(c1ccccc1)(c1ccc(C2CCCCCCC2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C51H53ClN2O5/c52-46-27-15-14-26-45(46)51(38-20-8-4-9-21-38,39-30-28-37(29-31-39)36-18-6-2-1-3-7-19-36)59-48(55)34-47(49(56)54-32-16-5-17-33-54)53-50(57)58-35-44-42-24-12-10-22-40(42)41-23-11-13-25-43(41)44/h4,8-15,20-31,36,44,47H,1-3,5-7,16-19,32-35H2,(H,53,57)/t47-,51?/m0/s1 |
| InChIKey | PLNIHZQVKAEVRS-YXUMVFQVSA-N |
| XLogP | 11.31 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.45 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|