C47H47ClN2O5 — CID 175256760
[(2-chlorophenyl)-diphenylmethyl] (3S)-4-(4-tert-butylpiperidin-1-yl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate (PubChem CID 175256760) has the molecular formula C47H47ClN2O5 and a molecular weight of 755.36 g/mol. Its IUPAC name is [(2-chlorophenyl)-diphenylmethyl] (3S)-4-(4-tert-butylpiperidin-1-yl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate.
| Compound Name | [(2-chlorophenyl)-diphenylmethyl] (3S)-4-(4-tert-butylpiperidin-1-yl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 175256760 |
| Molecular Formula | C47H47ClN2O5 |
| Molecular Weight | 755.36 g/mol |
| Exact Mass | 754.32 |
| IUPAC Name | [(2-chlorophenyl)-diphenylmethyl] (3S)-4-(4-tert-butylpiperidin-1-yl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate |
| SMILES | CC(C)(C)C1CCN(C(=O)[C@H](CC(=O)OC(c2ccccc2)(c2ccccc2)c2ccccc2Cl)NC(=O)OCC2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C47H47ClN2O5/c1-46(2,3)32-26-28-50(29-27-32)44(52)42(49-45(53)54-31-39-37-22-12-10-20-35(37)36-21-11-13-23-38(36)39)30-43(51)55-47(33-16-6-4-7-17-33,34-18-8-5-9-19-34)40-24-14-15-25-41(40)48/h4-25,32,39,42H,26-31H2,1-3H3,(H,49,53)/t42-/m0/s1 |
| InChIKey | UBOVLWSWYDJDMM-WBCKFURZSA-N |
| XLogP | 9.76 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.36 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|