C41H38ClNO4S2 — CID 102507999
[(2-chlorophenyl)-diphenylmethyl] (2R)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 102507999) has the molecular formula C41H38ClNO4S2 and a molecular weight of 708.35 g/mol. Its IUPAC name is [(2-chlorophenyl)-diphenylmethyl] (2R)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | [(2-chlorophenyl)-diphenylmethyl] (2R)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 102507999 |
| Molecular Formula | C41H38ClNO4S2 |
| Molecular Weight | 708.35 g/mol |
| Exact Mass | 707.19 |
| IUPAC Name | [(2-chlorophenyl)-diphenylmethyl] (2R)-3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)SSC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C41H38ClNO4S2/c1-40(2,3)49-48-27-37(43-39(45)46-26-34-32-22-12-10-20-30(32)31-21-11-13-23-33(31)34)38(44)47-41(28-16-6-4-7-17-28,29-18-8-5-9-19-29)35-24-14-15-25-36(35)42/h4-25,34,37H,26-27H2,1-3H3,(H,43,45)/t37-/m0/s1 |
| InChIKey | FVNOKZNCQSYURM-QNGWXLTQSA-N |
| XLogP | 10.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.35 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|