C27H33NO5S2 — CID 75220938
(3-methyloxetan-3-yl)methyl 3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 75220938) has the molecular formula C27H33NO5S2 and a molecular weight of 515.70 g/mol. Its IUPAC name is (3-methyloxetan-3-yl)methyl 3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | (3-methyloxetan-3-yl)methyl 3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 75220938 |
| Molecular Formula | C27H33NO5S2 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | (3-methyloxetan-3-yl)methyl 3-(tert-butyldisulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CC1(COC(=O)C(CSSC(C)(C)C)NC(=O)OCC2c3ccccc3-c3ccccc32)COC1 |
| InChI | InChI=1S/C27H33NO5S2/c1-26(2,3)35-34-14-23(24(29)33-17-27(4)15-31-16-27)28-25(30)32-13-22-20-11-7-5-9-18(20)19-10-6-8-12-21(19)22/h5-12,22-23H,13-17H2,1-4H3,(H,28,30) |
| InChIKey | VSMIHUQSZJCVTJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|