C49H51ClN2O5 — CID 167139917
[(2-chlorophenyl)-(4-cyclononylphenyl)-phenylmethyl] (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoate (PubChem CID 167139917) has the molecular formula C49H51ClN2O5 and a molecular weight of 783.41 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-cyclononylphenyl)-phenylmethyl] (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoate.
| Compound Name | [(2-chlorophenyl)-(4-cyclononylphenyl)-phenylmethyl] (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 167139917 |
| Molecular Formula | C49H51ClN2O5 |
| Molecular Weight | 783.41 g/mol |
| Exact Mass | 782.35 |
| IUPAC Name | [(2-chlorophenyl)-(4-cyclononylphenyl)-phenylmethyl] (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](C)C(=O)OC(c1ccccc1)(c1ccc(C2CCCCCCCC2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C49H51ClN2O5/c1-33(52-48(55)56-32-43-41-24-14-12-22-39(41)40-23-13-15-25-42(40)43)46(53)51-34(2)47(54)57-49(37-20-10-7-11-21-37,44-26-16-17-27-45(44)50)38-30-28-36(29-31-38)35-18-8-5-3-4-6-9-19-35/h7,10-17,20-31,33-35,43H,3-6,8-9,18-19,32H2,1-2H3,(H,51,53)(H,52,55)/t33-,34-,49?/m0/s1 |
| InChIKey | FBKMDKJYUKGHHO-DIJSJKGPSA-N |
| XLogP | 10.82 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.41 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|