C42H38ClNO4 — CID 170523615
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentyl]acetate (PubChem CID 170523615) has the molecular formula C42H38ClNO4 and a molecular weight of 656.22 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentyl]acetate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentyl]acetate |
|---|---|
| PubChem CID | 170523615 |
| Molecular Formula | C42H38ClNO4 |
| Molecular Weight | 656.22 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentyl]acetate |
| SMILES | Cc1ccc(C(OC(=O)CC2(NC(=O)OCC3c4ccccc4-c4ccccc43)CCCC2)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C42H38ClNO4/c1-29-21-23-31(24-22-29)42(30-13-3-2-4-14-30,37-19-9-10-20-38(37)43)48-39(45)27-41(25-11-12-26-41)44-40(46)47-28-36-34-17-7-5-15-32(34)33-16-6-8-18-35(33)36/h2-10,13-24,36H,11-12,25-28H2,1H3,(H,44,46) |
| InChIKey | HMOGOMMJZWLXLD-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.22 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|