C44H44ClNO5 — CID 168737519
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylbutoxy)butanoate (PubChem CID 168737519) has the molecular formula C44H44ClNO5 and a molecular weight of 702.29 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylbutoxy)butanoate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylbutoxy)butanoate |
|---|---|
| PubChem CID | 168737519 |
| Molecular Formula | C44H44ClNO5 |
| Molecular Weight | 702.29 g/mol |
| Exact Mass | 701.29 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-methylbutoxy)butanoate |
| SMILES | Cc1ccc(C(OC(=O)C[C@@H](COCCC(C)C)NC(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C44H44ClNO5/c1-30(2)25-26-49-28-34(46-43(48)50-29-39-37-17-9-7-15-35(37)36-16-8-10-18-38(36)39)27-42(47)51-44(32-13-5-4-6-14-32,33-23-21-31(3)22-24-33)40-19-11-12-20-41(40)45/h4-24,30,34,39H,25-29H2,1-3H3,(H,46,48)/t34-,44?/m0/s1 |
| InChIKey | TYONAHWTRLWUQT-JFBFOQHQSA-N |
| XLogP | 9.84 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.29 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|