C38H32ClNO4 — CID 168737401
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 168737401) has the molecular formula C38H32ClNO4 and a molecular weight of 602.13 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 168737401 |
| Molecular Formula | C38H32ClNO4 |
| Molecular Weight | 602.13 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | Cc1ccc(C(OC(=O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C38H32ClNO4/c1-26-19-21-28(22-20-26)38(27-11-3-2-4-12-27,34-17-9-10-18-35(34)39)44-36(41)23-24-40-37(42)43-25-33-31-15-7-5-13-29(31)30-14-6-8-16-32(30)33/h2-22,33H,23-25H2,1H3,(H,40,42) |
| InChIKey | NXVXOBOXSBRFCI-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.13 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|