C29H35ClNO4P — CID 162076373
1-O-tert-butyl 5-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-aminopentanedioate;phosphane (PubChem CID 162076373) has the molecular formula C29H35ClNO4P and a molecular weight of 528.03 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-aminopentanedioate;phosphane.
| Compound Name | 1-O-tert-butyl 5-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-aminopentanedioate;phosphane |
|---|---|
| PubChem CID | 162076373 |
| Molecular Formula | C29H35ClNO4P |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 1-O-tert-butyl 5-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-aminopentanedioate;phosphane |
| SMILES | Cc1ccc(C(OC(=O)CCC(N)C(=O)OC(C)(C)C)(c2ccccc2)c2ccccc2Cl)cc1.P |
| InChI | InChI=1S/C29H32ClNO4.H3P/c1-20-14-16-22(17-15-20)29(21-10-6-5-7-11-21,23-12-8-9-13-24(23)30)34-26(32)19-18-25(31)27(33)35-28(2,3)4;/h5-17,25H,18-19,31H2,1-4H3;1H3 |
| InChIKey | ZBTIHXILFGIWRK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|