C29H32ClNO4 — CID 51341083
5-O-tert-butyl 1-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2S)-2-aminopentanedioate (PubChem CID 51341083) has the molecular formula C29H32ClNO4 and a molecular weight of 494.03 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2S)-2-aminopentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2S)-2-aminopentanedioate |
|---|---|
| PubChem CID | 51341083 |
| Molecular Formula | C29H32ClNO4 |
| Molecular Weight | 494.03 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 5-O-tert-butyl 1-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2S)-2-aminopentanedioate |
| SMILES | Cc1ccc(C(OC(=O)[C@@H](N)CCC(=O)OC(C)(C)C)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C29H32ClNO4/c1-20-14-16-22(17-15-20)29(21-10-6-5-7-11-21,23-12-8-9-13-24(23)30)35-27(33)25(31)18-19-26(32)34-28(2,3)4/h5-17,25H,18-19,31H2,1-4H3/t25-,29?/m0/s1 |
| InChIKey | PWJJIGDDOQLJQO-GMMLNUAGSA-N |
| XLogP | 5.93 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.03 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|