C25H26ClNO2S — CID 155745443
[(2-chlorophenyl)-phenyl-(4-propylphenyl)methyl] 2-amino-3-sulfanylpropanoate (PubChem CID 155745443) has the molecular formula C25H26ClNO2S and a molecular weight of 440.01 g/mol. Its IUPAC name is [(2-chlorophenyl)-phenyl-(4-propylphenyl)methyl] 2-amino-3-sulfanylpropanoate.
| Compound Name | [(2-chlorophenyl)-phenyl-(4-propylphenyl)methyl] 2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 155745443 |
| Molecular Formula | C25H26ClNO2S |
| Molecular Weight | 440.01 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | [(2-chlorophenyl)-phenyl-(4-propylphenyl)methyl] 2-amino-3-sulfanylpropanoate |
| SMILES | CCCc1ccc(C(OC(=O)C(N)CS)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H26ClNO2S/c1-2-8-18-13-15-20(16-14-18)25(19-9-4-3-5-10-19,29-24(28)23(27)17-30)21-11-6-7-12-22(21)26/h3-7,9-16,23,30H,2,8,17,27H2,1H3 |
| InChIKey | SOHRRIYFJJSCLU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.01 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|