C35H37ClN2O4 — CID 175845041
[(2-chlorophenyl)-diphenylmethyl] (3R)-4-[[(2R)-1-amino-3-methoxypropan-2-yl]-methylamino]-3-benzyl-4-oxobutanoate (PubChem CID 175845041) has the molecular formula C35H37ClN2O4 and a molecular weight of 585.14 g/mol. Its IUPAC name is [(2-chlorophenyl)-diphenylmethyl] (3R)-4-[[(2R)-1-amino-3-methoxypropan-2-yl]-methylamino]-3-benzyl-4-oxobutanoate.
| Compound Name | [(2-chlorophenyl)-diphenylmethyl] (3R)-4-[[(2R)-1-amino-3-methoxypropan-2-yl]-methylamino]-3-benzyl-4-oxobutanoate |
|---|---|
| PubChem CID | 175845041 |
| Molecular Formula | C35H37ClN2O4 |
| Molecular Weight | 585.14 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | [(2-chlorophenyl)-diphenylmethyl] (3R)-4-[[(2R)-1-amino-3-methoxypropan-2-yl]-methylamino]-3-benzyl-4-oxobutanoate |
| SMILES | COC[C@@H](CN)N(C)C(=O)[C@@H](CC(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1Cl)Cc1ccccc1 |
| InChI | InChI=1S/C35H37ClN2O4/c1-38(30(24-37)25-41-2)34(40)27(22-26-14-6-3-7-15-26)23-33(39)42-35(28-16-8-4-9-17-28,29-18-10-5-11-19-29)31-20-12-13-21-32(31)36/h3-21,27,30H,22-25,37H2,1-2H3/t27-,30-/m1/s1 |
| InChIKey | CERILTPHPIYSJT-POURPWNDSA-N |
| XLogP | 5.86 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.14 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|