C27H29ClO2 — CID 59409015
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] heptanoate (PubChem CID 59409015) has the molecular formula C27H29ClO2 and a molecular weight of 420.98 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] heptanoate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] heptanoate |
|---|---|
| PubChem CID | 59409015 |
| Molecular Formula | C27H29ClO2 |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] heptanoate |
| SMILES | CCCCCCC(=O)OC(c1ccccc1)(c1ccc(C)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C27H29ClO2/c1-3-4-5-9-16-26(29)30-27(22-12-7-6-8-13-22,23-19-17-21(2)18-20-23)24-14-10-11-15-25(24)28/h6-8,10-15,17-20H,3-5,9,16H2,1-2H3 |
| InChIKey | DVSHRAWDAXSGTQ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|