C23H22ClNO2 — CID 21037585
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-aminopropanoate (PubChem CID 21037585) has the molecular formula C23H22ClNO2 and a molecular weight of 379.89 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-aminopropanoate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-aminopropanoate |
|---|---|
| PubChem CID | 21037585 |
| Molecular Formula | C23H22ClNO2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-aminopropanoate |
| SMILES | Cc1ccc(C(OC(=O)C(C)N)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H22ClNO2/c1-16-12-14-19(15-13-16)23(27-22(26)17(2)25,18-8-4-3-5-9-18)20-10-6-7-11-21(20)24/h3-15,17H,25H2,1-2H3 |
| InChIKey | YZIUYYALYHNGOZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|