C19H18O4S — CID 157199768
4-(9H-fluoren-9-ylmethoxy)-4-oxo-2-(sulfanylmethyl)butanoic acid (PubChem CID 157199768) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-(9H-fluoren-9-ylmethoxy)-4-oxo-2-(sulfanylmethyl)butanoic acid.
| Compound Name | 4-(9H-fluoren-9-ylmethoxy)-4-oxo-2-(sulfanylmethyl)butanoic acid |
|---|---|
| PubChem CID | 157199768 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-(9H-fluoren-9-ylmethoxy)-4-oxo-2-(sulfanylmethyl)butanoic acid |
| SMILES | O=C(CC(CS)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H18O4S/c20-18(9-12(11-24)19(21)22)23-10-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,12,17,24H,9-11H2,(H,21,22) |
| InChIKey | KRWFSYZGUUCXDY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|