C32H26O5 — CID 161419154
(2R)-2-[(4-benzoylphenyl)methyl]-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid (PubChem CID 161419154) has the molecular formula C32H26O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is (2R)-2-[(4-benzoylphenyl)methyl]-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid.
| Compound Name | (2R)-2-[(4-benzoylphenyl)methyl]-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 161419154 |
| Molecular Formula | C32H26O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (2R)-2-[(4-benzoylphenyl)methyl]-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid |
| SMILES | O=C(CC(Cc1ccc(C(=O)c2ccccc2)cc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H26O5/c33-30(37-20-29-27-12-6-4-10-25(27)26-11-5-7-13-28(26)29)19-24(32(35)36)18-21-14-16-23(17-15-21)31(34)22-8-2-1-3-9-22/h1-17,24,29H,18-20H2,(H,35,36) |
| InChIKey | VWMKZIODCMOPBD-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |