About 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate
4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate (PubChem CID 159838326) has the molecular formula C20H20O4S
and a molecular weight of 356.44 g/mol. Its IUPAC name is 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate.
Molecular Properties
| Compound Name | 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate |
| PubChem CID | 159838326 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate |
| SMILES | COC(=O)[C@H](CS)CC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H20O4S/c1-23-20(22)13(12-25)10-19(21)24-11-18-16-8-4-2-6-14(16)15-7-3-5-9-17(15)18/h2-9,13,18,25H,10-12H2,1H3/t13-/m0/s1 |
| InChIKey | NOJDAAHINIOOSK-ZDUSSCGKSA-N |
| XLogP | 3.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate?
The IUPAC name of 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate (CID 159838326) is 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate.
What is the SMILES notation for 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate?
The canonical SMILES for 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate is COC(=O)[C@H](CS)CC(=O)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate?
The InChIKey is NOJDAAHINIOOSK-ZDUSSCGKSA-N. The full InChI is InChI=1S/C20H20O4S/c1-23-20(22)13(12-25)10-19(21)24-11-18-16-8-4-2-6-14(16)15-7-3-5-9-17(15)18/h2-9,13,18,25H,10-12H2,1H3/t13-/m0/s1.
What are the key properties of 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate?
4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate has a molecular weight of 356.44 g/mol, XLogP of 3.45, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(9H-fluoren-9-ylmethyl) 1-O-methyl (2R)-2-(sulfanylmethyl)butanedioate is sourced from PubChem (CID 159838326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).