About 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate
9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate (PubChem CID 146329215) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate |
| PubChem CID | 146329215 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate |
| SMILES | CONCC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H17NO3/c1-20-18-10-17(19)21-11-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16,18H,10-11H2,1H3 |
| InChIKey | OBFKRYZKZUSPOJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate?
The IUPAC name of 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate (CID 146329215) is 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate?
The canonical SMILES for 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate is CONCC(=O)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate?
The InChIKey is OBFKRYZKZUSPOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3/c1-20-18-10-17(19)21-11-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16,18H,10-11H2,1H3.
What are the key properties of 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate?
9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate has a molecular weight of 283.33 g/mol, XLogP of 2.49, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl 2-(methoxyamino)acetate is sourced from PubChem (CID 146329215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).