C21H22O3 — CID 59055681
9H-fluoren-9-ylmethyl 4,4-dimethyl-3-oxopentanoate (PubChem CID 59055681) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4,4-dimethyl-3-oxopentanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 4,4-dimethyl-3-oxopentanoate |
|---|---|
| PubChem CID | 59055681 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4,4-dimethyl-3-oxopentanoate |
| SMILES | CC(C)(C)C(=O)CC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H22O3/c1-21(2,3)19(22)12-20(23)24-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18H,12-13H2,1-3H3 |
| InChIKey | TTYLTSYYBULAHZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|