C20H20O5 — CID 160737681
4-(9H-fluoren-9-ylmethoxy)-2-(hydroxymethyl)-2-methyl-4-oxobutanoic acid (PubChem CID 160737681) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-(9H-fluoren-9-ylmethoxy)-2-(hydroxymethyl)-2-methyl-4-oxobutanoic acid.
| Compound Name | 4-(9H-fluoren-9-ylmethoxy)-2-(hydroxymethyl)-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 160737681 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 4-(9H-fluoren-9-ylmethoxy)-2-(hydroxymethyl)-2-methyl-4-oxobutanoic acid |
| SMILES | CC(CO)(CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C20H20O5/c1-20(12-21,19(23)24)10-18(22)25-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17,21H,10-12H2,1H3,(H,23,24) |
| InChIKey | LWHPTUMMLPUSLL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |