C23H25NO4 — CID 67384206
4-[1-amino-2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid (PubChem CID 67384206) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-[1-amino-2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[1-amino-2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67384206 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 4-[1-amino-2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]cyclohexane-1-carboxylic acid |
| SMILES | NC(C(=O)OCC1c2ccccc2-c2ccccc21)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C23H25NO4/c24-21(14-9-11-15(12-10-14)22(25)26)23(27)28-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,14-15,20-21H,9-13,24H2,(H,25,26) |
| InChIKey | WINGNDRAHMGPBV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |