C38H36O18S3-2 — CID 157234890
9-[[(3R)-3-carboxybutanoyl]oxymethyl]-9H-fluorene-3,6-disulfonate;(2R)-4-(9H-fluoren-9-ylmethoxy)-2-methyl-4-oxobutanoic acid;sulfuric acid (PubChem CID 157234890) has the molecular formula C38H36O18S3-2 and a molecular weight of 876.89 g/mol. Its IUPAC name is 9-[[(3R)-3-carboxybutanoyl]oxymethyl]-9H-fluorene-3,6-disulfonate;(2R)-4-(9H-fluoren-9-ylmethoxy)-2-methyl-4-oxobutanoic acid;sulfuric acid.
| Compound Name | 9-[[(3R)-3-carboxybutanoyl]oxymethyl]-9H-fluorene-3,6-disulfonate;(2R)-4-(9H-fluoren-9-ylmethoxy)-2-methyl-4-oxobutanoic acid;sulfuric acid |
|---|---|
| PubChem CID | 157234890 |
| Molecular Formula | C38H36O18S3-2 |
| Molecular Weight | 876.89 g/mol |
| Exact Mass | 876.11 |
| IUPAC Name | 9-[[(3R)-3-carboxybutanoyl]oxymethyl]-9H-fluorene-3,6-disulfonate;(2R)-4-(9H-fluoren-9-ylmethoxy)-2-methyl-4-oxobutanoic acid;sulfuric acid |
| SMILES | C[C@H](CC(=O)OCC1c2ccc(S(=O)(=O)[O-])cc2-c2cc(S(=O)(=O)[O-])ccc21)C(=O)O.C[C@H](CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C19H18O10S2.C19H18O4.H2O4S/c1-10(19(21)22)6-18(20)29-9-17-13-4-2-11(30(23,24)25)7-15(13)16-8-12(31(26,27)28)3-5-14(16)17;1-12(19(21)22)10-18(20)23-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17;1-5(2,3)4/h2-5,7-8,10,17H,6,9H2,1H3,(H,21,22)(H,23,24,25)(H,26,27,28);2-9,12,17H,10-11H2,1H3,(H,21,22);(H2,1,2,3,4)/p-2/t10-;12-;/m11./s1 |
| InChIKey | PVJBVZOPJDEPNM-GOZVBPGLSA-L |
| XLogP | 4.06 |
| TPSA | 316.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.89 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|