C35H35NO7S — CID 87542228
1-O-(9H-fluoren-9-ylmethyl) 5-O-propan-2-yl 2-amino-3-[4-(4-methylphenyl)sulfonyloxyphenyl]pentanedioate (PubChem CID 87542228) has the molecular formula C35H35NO7S and a molecular weight of 613.73 g/mol. Its IUPAC name is 1-O-(9H-fluoren-9-ylmethyl) 5-O-propan-2-yl 2-amino-3-[4-(4-methylphenyl)sulfonyloxyphenyl]pentanedioate.
| Compound Name | 1-O-(9H-fluoren-9-ylmethyl) 5-O-propan-2-yl 2-amino-3-[4-(4-methylphenyl)sulfonyloxyphenyl]pentanedioate |
|---|---|
| PubChem CID | 87542228 |
| Molecular Formula | C35H35NO7S |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | 1-O-(9H-fluoren-9-ylmethyl) 5-O-propan-2-yl 2-amino-3-[4-(4-methylphenyl)sulfonyloxyphenyl]pentanedioate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(CC(=O)OC(C)C)C(N)C(=O)OCC3c4ccccc4-c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C35H35NO7S/c1-22(2)42-33(37)20-31(24-14-16-25(17-15-24)43-44(39,40)26-18-12-23(3)13-19-26)34(36)35(38)41-21-32-29-10-6-4-8-27(29)28-9-5-7-11-30(28)32/h4-19,22,31-32,34H,20-21,36H2,1-3H3 |
| InChIKey | VBBULCVWRAERTB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|