C32H29NO7S — CID 87298347
1-O-(9H-fluoren-9-ylmethyl) 5-O-methyl 3-amino-2-[4-(benzenesulfonyloxy)phenyl]pentanedioate (PubChem CID 87298347) has the molecular formula C32H29NO7S and a molecular weight of 571.65 g/mol. Its IUPAC name is 1-O-(9H-fluoren-9-ylmethyl) 5-O-methyl 3-amino-2-[4-(benzenesulfonyloxy)phenyl]pentanedioate.
| Compound Name | 1-O-(9H-fluoren-9-ylmethyl) 5-O-methyl 3-amino-2-[4-(benzenesulfonyloxy)phenyl]pentanedioate |
|---|---|
| PubChem CID | 87298347 |
| Molecular Formula | C32H29NO7S |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 1-O-(9H-fluoren-9-ylmethyl) 5-O-methyl 3-amino-2-[4-(benzenesulfonyloxy)phenyl]pentanedioate |
| SMILES | COC(=O)CC(N)C(C(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H29NO7S/c1-38-30(34)19-29(33)31(21-15-17-22(18-16-21)40-41(36,37)23-9-3-2-4-10-23)32(35)39-20-28-26-13-7-5-11-24(26)25-12-6-8-14-27(25)28/h2-18,28-29,31H,19-20,33H2,1H3 |
| InChIKey | BCFCVHISAOAAHF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|