C25H21ClFNO3 — CID 174782761
9H-fluoren-9-ylmethyl 3-amino-5-chloro-2-(4-fluorophenyl)-5-oxopentanoate (PubChem CID 174782761) has the molecular formula C25H21ClFNO3 and a molecular weight of 437.90 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-amino-5-chloro-2-(4-fluorophenyl)-5-oxopentanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-amino-5-chloro-2-(4-fluorophenyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 174782761 |
| Molecular Formula | C25H21ClFNO3 |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-amino-5-chloro-2-(4-fluorophenyl)-5-oxopentanoate |
| SMILES | NC(CC(=O)Cl)C(C(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H21ClFNO3/c26-23(29)13-22(28)24(15-9-11-16(27)12-10-15)25(30)31-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22,24H,13-14,28H2 |
| InChIKey | XOPFDCKAVHVNMM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|