C25H22ClNO4 — CID 24820695
(3S)-3-amino-4-(3-chlorophenyl)-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid (PubChem CID 24820695) has the molecular formula C25H22ClNO4 and a molecular weight of 435.91 g/mol. Its IUPAC name is (3S)-3-amino-4-(3-chlorophenyl)-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid.
| Compound Name | (3S)-3-amino-4-(3-chlorophenyl)-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 24820695 |
| Molecular Formula | C25H22ClNO4 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (3S)-3-amino-4-(3-chlorophenyl)-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(C(=O)OCC1c2ccccc2-c2ccccc21)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H22ClNO4/c26-16-7-5-6-15(12-16)24(22(27)13-23(28)29)25(30)31-14-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-12,21-22,24H,13-14,27H2,(H,28,29)/t22-,24?/m0/s1 |
| InChIKey | ZFJBDWMQQYJVFW-OWJIYDKWSA-N |
| XLogP | 4.58 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |