C25H21F2NO4 — CID 24820617
(3R)-3-amino-4-(3,4-difluorophenyl)-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid (PubChem CID 24820617) has the molecular formula C25H21F2NO4 and a molecular weight of 437.44 g/mol. Its IUPAC name is (3R)-3-amino-4-(3,4-difluorophenyl)-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid.
| Compound Name | (3R)-3-amino-4-(3,4-difluorophenyl)-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 24820617 |
| Molecular Formula | C25H21F2NO4 |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (3R)-3-amino-4-(3,4-difluorophenyl)-5-(9H-fluoren-9-ylmethoxy)-5-oxopentanoic acid |
| SMILES | N[C@H](CC(=O)O)C(C(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H21F2NO4/c26-20-10-9-14(11-21(20)27)24(22(28)12-23(29)30)25(31)32-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-11,19,22,24H,12-13,28H2,(H,29,30)/t22-,24?/m1/s1 |
| InChIKey | ZMWSPVZVUGBHFO-LETIRJCYSA-N |
| XLogP | 4.21 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |