C26H22F3NO4 — CID 24820634
(3R)-3-amino-5-(9H-fluoren-9-ylmethoxy)-5-oxo-4-[4-(trifluoromethyl)phenyl]pentanoic acid (PubChem CID 24820634) has the molecular formula C26H22F3NO4 and a molecular weight of 469.46 g/mol. Its IUPAC name is (3R)-3-amino-5-(9H-fluoren-9-ylmethoxy)-5-oxo-4-[4-(trifluoromethyl)phenyl]pentanoic acid.
| Compound Name | (3R)-3-amino-5-(9H-fluoren-9-ylmethoxy)-5-oxo-4-[4-(trifluoromethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 24820634 |
| Molecular Formula | C26H22F3NO4 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (3R)-3-amino-5-(9H-fluoren-9-ylmethoxy)-5-oxo-4-[4-(trifluoromethyl)phenyl]pentanoic acid |
| SMILES | N[C@H](CC(=O)O)C(C(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H22F3NO4/c27-26(28,29)16-11-9-15(10-12-16)24(22(30)13-23(31)32)25(33)34-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22,24H,13-14,30H2,(H,31,32)/t22-,24?/m1/s1 |
| InChIKey | IEMUKRXXJRSUPL-LETIRJCYSA-N |
| XLogP | 4.95 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |