C34H33NO7S — CID 87297882
tert-butyl 3-[4-(benzenesulfonyloxy)phenyl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 87297882) has the molecular formula C34H33NO7S and a molecular weight of 599.71 g/mol. Its IUPAC name is tert-butyl 3-[4-(benzenesulfonyloxy)phenyl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | tert-butyl 3-[4-(benzenesulfonyloxy)phenyl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 87297882 |
| Molecular Formula | C34H33NO7S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | tert-butyl 3-[4-(benzenesulfonyloxy)phenyl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)OC(=O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H33NO7S/c1-34(2,3)41-32(36)21-31(23-17-19-24(20-18-23)42-43(38,39)25-11-5-4-6-12-25)35-33(37)40-22-30-28-15-9-7-13-26(28)27-14-8-10-16-29(27)30/h4-20,30-31H,21-22H2,1-3H3,(H,35,37) |
| InChIKey | NPVOJSZQLZYKCZ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|