C32H29NO7S — CID 87296825
methyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate (PubChem CID 87296825) has the molecular formula C32H29NO7S and a molecular weight of 571.65 g/mol. Its IUPAC name is methyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate.
| Compound Name | methyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate |
|---|---|
| PubChem CID | 87296825 |
| Molecular Formula | C32H29NO7S |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | methyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate |
| SMILES | COC(=O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H29NO7S/c1-21-11-17-24(18-12-21)41(36,37)40-23-15-13-22(14-16-23)30(19-31(34)38-2)33-32(35)39-20-29-27-9-5-3-7-25(27)26-8-4-6-10-28(26)29/h3-18,29-30H,19-20H2,1-2H3,(H,33,35) |
| InChIKey | QSNBFLOSCLDTMH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|