C45H43NO3 — CID 158360660
bis(4-methylphenyl)methanol;9H-fluoren-9-ylmethyl N-[bis(4-methylphenyl)methyl]carbamate (PubChem CID 158360660) has the molecular formula C45H43NO3 and a molecular weight of 645.84 g/mol. Its IUPAC name is bis(4-methylphenyl)methanol;9H-fluoren-9-ylmethyl N-[bis(4-methylphenyl)methyl]carbamate.
| Compound Name | bis(4-methylphenyl)methanol;9H-fluoren-9-ylmethyl N-[bis(4-methylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 158360660 |
| Molecular Formula | C45H43NO3 |
| Molecular Weight | 645.84 g/mol |
| Exact Mass | 645.32 |
| IUPAC Name | bis(4-methylphenyl)methanol;9H-fluoren-9-ylmethyl N-[bis(4-methylphenyl)methyl]carbamate |
| SMILES | Cc1ccc(C(NC(=O)OCC2c3ccccc3-c3ccccc32)c2ccc(C)cc2)cc1.Cc1ccc(C(O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H27NO2.C15H16O/c1-20-11-15-22(16-12-20)29(23-17-13-21(2)14-18-23)31-30(32)33-19-28-26-9-5-3-7-24(26)25-8-4-6-10-27(25)28;1-11-3-7-13(8-4-11)15(16)14-9-5-12(2)6-10-14/h3-18,28-29H,19H2,1-2H3,(H,31,32);3-10,15-16H,1-2H3 |
| InChIKey | GTKUSBQOOOVCCS-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.84 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |