C26H29NO5S — CID 87297599
propan-2-yl 3-amino-2-[4-(4-methylphenyl)sulfonyloxyphenyl]-4-phenylbutanoate (PubChem CID 87297599) has the molecular formula C26H29NO5S and a molecular weight of 467.59 g/mol. Its IUPAC name is propan-2-yl 3-amino-2-[4-(4-methylphenyl)sulfonyloxyphenyl]-4-phenylbutanoate.
| Compound Name | propan-2-yl 3-amino-2-[4-(4-methylphenyl)sulfonyloxyphenyl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 87297599 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | propan-2-yl 3-amino-2-[4-(4-methylphenyl)sulfonyloxyphenyl]-4-phenylbutanoate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(C(=O)OC(C)C)C(N)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H29NO5S/c1-18(2)31-26(28)25(24(27)17-20-7-5-4-6-8-20)21-11-13-22(14-12-21)32-33(29,30)23-15-9-19(3)10-16-23/h4-16,18,24-25H,17,27H2,1-3H3 |
| InChIKey | QONWDHCSLLRAIB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|