C24H25NO5S — CID 87297118
methyl 3-(benzylamino)-2-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate (PubChem CID 87297118) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is methyl 3-(benzylamino)-2-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate.
| Compound Name | methyl 3-(benzylamino)-2-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate |
|---|---|
| PubChem CID | 87297118 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | methyl 3-(benzylamino)-2-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate |
| SMILES | COC(=O)C(CNCc1ccccc1)c1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H25NO5S/c1-18-8-14-22(15-9-18)31(27,28)30-21-12-10-20(11-13-21)23(24(26)29-2)17-25-16-19-6-4-3-5-7-19/h3-15,23,25H,16-17H2,1-2H3 |
| InChIKey | MKZHQAQNVZVUTL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|