C23H23NO5S — CID 87296862
methyl 3-amino-2-[3-(benzenesulfonyloxy)phenyl]-4-phenylbutanoate (PubChem CID 87296862) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is methyl 3-amino-2-[3-(benzenesulfonyloxy)phenyl]-4-phenylbutanoate.
| Compound Name | methyl 3-amino-2-[3-(benzenesulfonyloxy)phenyl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 87296862 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | methyl 3-amino-2-[3-(benzenesulfonyloxy)phenyl]-4-phenylbutanoate |
| SMILES | COC(=O)C(c1cccc(OS(=O)(=O)c2ccccc2)c1)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C23H23NO5S/c1-28-23(25)22(21(24)15-17-9-4-2-5-10-17)18-11-8-12-19(16-18)29-30(26,27)20-13-6-3-7-14-20/h2-14,16,21-22H,15,24H2,1H3 |
| InChIKey | UMSRPXQDJRAMHH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|