C21H19NO7S2 — CID 10766425
methyl 2-(benzenesulfonamido)-2-[4-(benzenesulfonyloxy)phenyl]acetate (PubChem CID 10766425) has the molecular formula C21H19NO7S2 and a molecular weight of 461.52 g/mol. Its IUPAC name is methyl 2-(benzenesulfonamido)-2-[4-(benzenesulfonyloxy)phenyl]acetate.
| Compound Name | methyl 2-(benzenesulfonamido)-2-[4-(benzenesulfonyloxy)phenyl]acetate |
|---|---|
| PubChem CID | 10766425 |
| Molecular Formula | C21H19NO7S2 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | methyl 2-(benzenesulfonamido)-2-[4-(benzenesulfonyloxy)phenyl]acetate |
| SMILES | COC(=O)C(NS(=O)(=O)c1ccccc1)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO7S2/c1-28-21(23)20(22-30(24,25)18-8-4-2-5-9-18)16-12-14-17(15-13-16)29-31(26,27)19-10-6-3-7-11-19/h2-15,20,22H,1H3 |
| InChIKey | UQDHSJNJTDKCTH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|