C22H20BrNO5S — CID 154634382
methyl (2R)-2-[(4-bromophenyl)sulfonylamino]-2-(4-phenylmethoxyphenyl)acetate (PubChem CID 154634382) has the molecular formula C22H20BrNO5S and a molecular weight of 490.38 g/mol. Its IUPAC name is methyl (2R)-2-[(4-bromophenyl)sulfonylamino]-2-(4-phenylmethoxyphenyl)acetate.
| Compound Name | methyl (2R)-2-[(4-bromophenyl)sulfonylamino]-2-(4-phenylmethoxyphenyl)acetate |
|---|---|
| PubChem CID | 154634382 |
| Molecular Formula | C22H20BrNO5S |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | methyl (2R)-2-[(4-bromophenyl)sulfonylamino]-2-(4-phenylmethoxyphenyl)acetate |
| SMILES | COC(=O)[C@H](NS(=O)(=O)c1ccc(Br)cc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20BrNO5S/c1-28-22(25)21(24-30(26,27)20-13-9-18(23)10-14-20)17-7-11-19(12-8-17)29-15-16-5-3-2-4-6-16/h2-14,21,24H,15H2,1H3/t21-/m1/s1 |
| InChIKey | FZXYRGFEYVWDNN-OAQYLSRUSA-N |
| XLogP | 4.22 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |