C25H27NO5S — CID 23034449
tert-butyl 2-[4-(benzenesulfonyloxy)phenyl]-2-(benzylamino)acetate (PubChem CID 23034449) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is tert-butyl 2-[4-(benzenesulfonyloxy)phenyl]-2-(benzylamino)acetate.
| Compound Name | tert-butyl 2-[4-(benzenesulfonyloxy)phenyl]-2-(benzylamino)acetate |
|---|---|
| PubChem CID | 23034449 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | tert-butyl 2-[4-(benzenesulfonyloxy)phenyl]-2-(benzylamino)acetate |
| SMILES | CC(C)(C)OC(=O)C(NCc1ccccc1)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO5S/c1-25(2,3)30-24(27)23(26-18-19-10-6-4-7-11-19)20-14-16-21(17-15-20)31-32(28,29)22-12-8-5-9-13-22/h4-17,23,26H,18H2,1-3H3 |
| InChIKey | HMTNMCFTCDLCRE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|