C29H33NO7S — CID 87297981
5-O-benzyl 1-O-tert-butyl 3-(aminomethyl)-2-[4-(benzenesulfonyloxy)phenyl]pentanedioate (PubChem CID 87297981) has the molecular formula C29H33NO7S and a molecular weight of 539.65 g/mol. Its IUPAC name is 5-O-benzyl 1-O-tert-butyl 3-(aminomethyl)-2-[4-(benzenesulfonyloxy)phenyl]pentanedioate.
| Compound Name | 5-O-benzyl 1-O-tert-butyl 3-(aminomethyl)-2-[4-(benzenesulfonyloxy)phenyl]pentanedioate |
|---|---|
| PubChem CID | 87297981 |
| Molecular Formula | C29H33NO7S |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 5-O-benzyl 1-O-tert-butyl 3-(aminomethyl)-2-[4-(benzenesulfonyloxy)phenyl]pentanedioate |
| SMILES | CC(C)(C)OC(=O)C(c1ccc(OS(=O)(=O)c2ccccc2)cc1)C(CN)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H33NO7S/c1-29(2,3)36-28(32)27(23(19-30)18-26(31)35-20-21-10-6-4-7-11-21)22-14-16-24(17-15-22)37-38(33,34)25-12-8-5-9-13-25/h4-17,23,27H,18-20,30H2,1-3H3 |
| InChIKey | PNAGEBCECUTACF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|