C27H31NO5S — CID 87298157
propan-2-yl 3-(aminomethyl)-4-[4-(benzenesulfonyloxy)phenyl]-5-phenylpentanoate (PubChem CID 87298157) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is propan-2-yl 3-(aminomethyl)-4-[4-(benzenesulfonyloxy)phenyl]-5-phenylpentanoate.
| Compound Name | propan-2-yl 3-(aminomethyl)-4-[4-(benzenesulfonyloxy)phenyl]-5-phenylpentanoate |
|---|---|
| PubChem CID | 87298157 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | propan-2-yl 3-(aminomethyl)-4-[4-(benzenesulfonyloxy)phenyl]-5-phenylpentanoate |
| SMILES | CC(C)OC(=O)CC(CN)C(Cc1ccccc1)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H31NO5S/c1-20(2)32-27(29)18-23(19-28)26(17-21-9-5-3-6-10-21)22-13-15-24(16-14-22)33-34(30,31)25-11-7-4-8-12-25/h3-16,20,23,26H,17-19,28H2,1-2H3 |
| InChIKey | CYLFJHJXWAYACQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|