C24H25NO5S — CID 23034317
propan-2-yl 2-[4-(benzenesulfonyloxy)phenyl]-2-(benzylamino)acetate (PubChem CID 23034317) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is propan-2-yl 2-[4-(benzenesulfonyloxy)phenyl]-2-(benzylamino)acetate.
| Compound Name | propan-2-yl 2-[4-(benzenesulfonyloxy)phenyl]-2-(benzylamino)acetate |
|---|---|
| PubChem CID | 23034317 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | propan-2-yl 2-[4-(benzenesulfonyloxy)phenyl]-2-(benzylamino)acetate |
| SMILES | CC(C)OC(=O)C(NCc1ccccc1)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO5S/c1-18(2)29-24(26)23(25-17-19-9-5-3-6-10-19)20-13-15-21(16-14-20)30-31(27,28)22-11-7-4-8-12-22/h3-16,18,23,25H,17H2,1-2H3 |
| InChIKey | AKVGUWZGXWNTJY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|