C19H19NO8S — CID 45377600
methyl (2R)-3-[4-(benzenesulfonyloxy)phenyl]-2-[(2-methoxy-2-oxoacetyl)amino]propanoate (PubChem CID 45377600) has the molecular formula C19H19NO8S and a molecular weight of 421.43 g/mol. Its IUPAC name is methyl (2R)-3-[4-(benzenesulfonyloxy)phenyl]-2-[(2-methoxy-2-oxoacetyl)amino]propanoate.
| Compound Name | methyl (2R)-3-[4-(benzenesulfonyloxy)phenyl]-2-[(2-methoxy-2-oxoacetyl)amino]propanoate |
|---|---|
| PubChem CID | 45377600 |
| Molecular Formula | C19H19NO8S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | methyl (2R)-3-[4-(benzenesulfonyloxy)phenyl]-2-[(2-methoxy-2-oxoacetyl)amino]propanoate |
| SMILES | COC(=O)C(=O)N[C@H](Cc1ccc(OS(=O)(=O)c2ccccc2)cc1)C(=O)OC |
| InChI | InChI=1S/C19H19NO8S/c1-26-18(22)16(20-17(21)19(23)27-2)12-13-8-10-14(11-9-13)28-29(24,25)15-6-4-3-5-7-15/h3-11,16H,12H2,1-2H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | SYRVAKBHRWMQKE-MRXNPFEDSA-N |
| XLogP | 0.83 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|