C19H19NO10S — CID 75112507
3-[4-(3,4-dimethoxyphenyl)sulfonyloxyphenyl]-2-(oxaloamino)propanoic acid (PubChem CID 75112507) has the molecular formula C19H19NO10S and a molecular weight of 453.43 g/mol. Its IUPAC name is 3-[4-(3,4-dimethoxyphenyl)sulfonyloxyphenyl]-2-(oxaloamino)propanoic acid.
| Compound Name | 3-[4-(3,4-dimethoxyphenyl)sulfonyloxyphenyl]-2-(oxaloamino)propanoic acid |
|---|---|
| PubChem CID | 75112507 |
| Molecular Formula | C19H19NO10S |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 3-[4-(3,4-dimethoxyphenyl)sulfonyloxyphenyl]-2-(oxaloamino)propanoic acid |
| SMILES | COc1ccc(S(=O)(=O)Oc2ccc(CC(NC(=O)C(=O)O)C(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C19H19NO10S/c1-28-15-8-7-13(10-16(15)29-2)31(26,27)30-12-5-3-11(4-6-12)9-14(18(22)23)20-17(21)19(24)25/h3-8,10,14H,9H2,1-2H3,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | IHPUWQINYGSCMH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|