C15H19NO8S — CID 45376645
(2R)-3-(4-butylsulfonyloxyphenyl)-2-(oxaloamino)propanoic acid (PubChem CID 45376645) has the molecular formula C15H19NO8S and a molecular weight of 373.38 g/mol. Its IUPAC name is (2R)-3-(4-butylsulfonyloxyphenyl)-2-(oxaloamino)propanoic acid.
| Compound Name | (2R)-3-(4-butylsulfonyloxyphenyl)-2-(oxaloamino)propanoic acid |
|---|---|
| PubChem CID | 45376645 |
| Molecular Formula | C15H19NO8S |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | (2R)-3-(4-butylsulfonyloxyphenyl)-2-(oxaloamino)propanoic acid |
| SMILES | CCCCS(=O)(=O)Oc1ccc(C[C@@H](NC(=O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO8S/c1-2-3-8-25(22,23)24-11-6-4-10(5-7-11)9-12(14(18)19)16-13(17)15(20)21/h4-7,12H,2-3,8-9H2,1H3,(H,16,17)(H,18,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | SFYNYZQGTBBHME-GFCCVEGCSA-N |
| XLogP | 0.39 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|