C18H21NO7 — CID 56681515
3-[4-(cyclohexanecarbonyloxy)phenyl]-2-(oxaloamino)propanoic acid (PubChem CID 56681515) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is 3-[4-(cyclohexanecarbonyloxy)phenyl]-2-(oxaloamino)propanoic acid.
| Compound Name | 3-[4-(cyclohexanecarbonyloxy)phenyl]-2-(oxaloamino)propanoic acid |
|---|---|
| PubChem CID | 56681515 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-[4-(cyclohexanecarbonyloxy)phenyl]-2-(oxaloamino)propanoic acid |
| SMILES | O=C(O)C(=O)NC(Cc1ccc(OC(=O)C2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C18H21NO7/c20-15(17(23)24)19-14(16(21)22)10-11-6-8-13(9-7-11)26-18(25)12-4-2-1-3-5-12/h6-9,12,14H,1-5,10H2,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | ONJCVYLQMIQGJV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|