C19H19NO8S — CID 45377462
(2R)-3-[4-(3,5-dimethylphenyl)sulfonyloxyphenyl]-2-(oxaloamino)propanoic acid (PubChem CID 45377462) has the molecular formula C19H19NO8S and a molecular weight of 421.43 g/mol. Its IUPAC name is (2R)-3-[4-(3,5-dimethylphenyl)sulfonyloxyphenyl]-2-(oxaloamino)propanoic acid.
| Compound Name | (2R)-3-[4-(3,5-dimethylphenyl)sulfonyloxyphenyl]-2-(oxaloamino)propanoic acid |
|---|---|
| PubChem CID | 45377462 |
| Molecular Formula | C19H19NO8S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (2R)-3-[4-(3,5-dimethylphenyl)sulfonyloxyphenyl]-2-(oxaloamino)propanoic acid |
| SMILES | Cc1cc(C)cc(S(=O)(=O)Oc2ccc(C[C@@H](NC(=O)C(=O)O)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C19H19NO8S/c1-11-7-12(2)9-15(8-11)29(26,27)28-14-5-3-13(4-6-14)10-16(18(22)23)20-17(21)19(24)25/h3-9,16H,10H2,1-2H3,(H,20,21)(H,22,23)(H,24,25)/t16-/m1/s1 |
| InChIKey | KIDRJXJPGYFXJK-MRXNPFEDSA-N |
| XLogP | 1.27 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|