C25H30N4O15S2 — CID 10168884
(3S)-3-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(4-sulfooxyphenyl)propanoyl]amino]-4-[[(1S)-1-carboxy-2-(4-sulfooxyphenyl)ethyl]amino]-4-oxobutanoic acid (PubChem CID 10168884) has the molecular formula C25H30N4O15S2 and a molecular weight of 690.66 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(4-sulfooxyphenyl)propanoyl]amino]-4-[[(1S)-1-carboxy-2-(4-sulfooxyphenyl)ethyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(4-sulfooxyphenyl)propanoyl]amino]-4-[[(1S)-1-carboxy-2-(4-sulfooxyphenyl)ethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10168884 |
| Molecular Formula | C25H30N4O15S2 |
| Molecular Weight | 690.66 g/mol |
| Exact Mass | 690.11 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(4-sulfooxyphenyl)propanoyl]amino]-4-[[(1S)-1-carboxy-2-(4-sulfooxyphenyl)ethyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](Cc1ccc(OS(=O)(=O)O)cc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccc(OS(=O)(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C25H30N4O15S2/c1-13(26)22(32)27-18(10-14-2-6-16(7-3-14)43-45(37,38)39)23(33)28-19(12-21(30)31)24(34)29-20(25(35)36)11-15-4-8-17(9-5-15)44-46(40,41)42/h2-9,13,18-20H,10-12,26H2,1H3,(H,27,32)(H,28,33)(H,29,34)(H,30,31)(H,35,36)(H,37,38,39)(H,40,41,42)/t13-,18-,19-,20-/m0/s1 |
| InChIKey | UZHFCOOUQOYDEO-KJYZGMDISA-N |
| XLogP | -1.80 |
| TPSA | 315.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.66 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|