C19H26N4O12S — CID 10230371
(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(4-sulfooxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid (PubChem CID 10230371) has the molecular formula C19H26N4O12S and a molecular weight of 534.50 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(4-sulfooxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(4-sulfooxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 10230371 |
| Molecular Formula | C19H26N4O12S |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(4-sulfooxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
| SMILES | NCC(=O)N[C@@H](Cc1ccc(OS(=O)(=O)O)cc1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H26N4O12S/c20-8-15(25)21-13(7-10-1-3-11(4-2-10)35-36(32,33)34)17(28)23-14(9-24)18(29)22-12(19(30)31)5-6-16(26)27/h1-4,12-14,24H,5-9,20H2,(H,21,25)(H,22,29)(H,23,28)(H,26,27)(H,30,31)(H,32,33,34)/t12-,13-,14-/m0/s1 |
| InChIKey | GWNHCGCZMVPMTJ-IHRRRGAJSA-N |
| XLogP | -3.23 |
| TPSA | 271.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|