C20H19NO8 — CID 45376783
(2R)-3-[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]-2-(oxaloamino)propanoic acid (PubChem CID 45376783) has the molecular formula C20H19NO8 and a molecular weight of 401.37 g/mol. Its IUPAC name is (2R)-3-[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]-2-(oxaloamino)propanoic acid.
| Compound Name | (2R)-3-[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]-2-(oxaloamino)propanoic acid |
|---|---|
| PubChem CID | 45376783 |
| Molecular Formula | C20H19NO8 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (2R)-3-[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]-2-(oxaloamino)propanoic acid |
| SMILES | COc1cccc(C(=O)COc2ccc(C[C@@H](NC(=O)C(=O)O)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C20H19NO8/c1-28-15-4-2-3-13(10-15)17(22)11-29-14-7-5-12(6-8-14)9-16(19(24)25)21-18(23)20(26)27/h2-8,10,16H,9,11H2,1H3,(H,21,23)(H,24,25)(H,26,27)/t16-/m1/s1 |
| InChIKey | MLYLPPLKARNZKO-MRXNPFEDSA-N |
| XLogP | 1.15 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|